C18H25N3O5 — CID 70384515
but-2-enedioic acid;8-[2-(dimethylamino)ethyl]-6-methyl-8,9-dihydro-7H-pyrido[3,2-c]azepin-5-one (PubChem CID 70384515) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is but-2-enedioic acid;8-[2-(dimethylamino)ethyl]-6-methyl-8,9-dihydro-7H-pyrido[3,2-c]azepin-5-one.
| Compound Name | but-2-enedioic acid;8-[2-(dimethylamino)ethyl]-6-methyl-8,9-dihydro-7H-pyrido[3,2-c]azepin-5-one |
|---|---|
| PubChem CID | 70384515 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | but-2-enedioic acid;8-[2-(dimethylamino)ethyl]-6-methyl-8,9-dihydro-7H-pyrido[3,2-c]azepin-5-one |
| SMILES | CN(C)CCC1Cc2ncccc2C(=O)N(C)C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C14H21N3O.C4H4O4/c1-16(2)8-6-11-9-13-12(5-4-7-15-13)14(18)17(3)10-11;5-3(6)1-2-4(7)8/h4-5,7,11H,6,8-10H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | KAHABLGEIGSZND-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|