About 2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid
2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid (PubChem CID 70384633) has the molecular formula C8H8N2O3
and a molecular weight of 180.16 g/mol. Its IUPAC name is 2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid |
| PubChem CID | 70384633 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid |
| SMILES | O=C(O)N1C(=O)NC2CC=CC=C21 |
| InChI | InChI=1S/C8H8N2O3/c11-7-9-5-3-1-2-4-6(5)10(7)8(12)13/h1-2,4-5H,3H2,(H,9,11)(H,12,13) |
| InChIKey | CAXCFNAIEBLZOX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid?
The IUPAC name of 2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid (CID 70384633) is 2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid.
What is the SMILES notation for 2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid?
The canonical SMILES for 2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid is O=C(O)N1C(=O)NC2CC=CC=C21.
What is the InChIKey of 2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid?
The InChIKey is CAXCFNAIEBLZOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3/c11-7-9-5-3-1-2-4-6(5)10(7)8(12)13/h1-2,4-5H,3H2,(H,9,11)(H,12,13).
What are the key properties of 2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid?
2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid has a molecular weight of 180.16 g/mol, XLogP of 0.90, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3a,4-dihydro-3H-benzimidazole-1-carboxylic acid is sourced from PubChem (CID 70384633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).