C15H11NO3 — CID 70384843
6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid (PubChem CID 70384843) has the molecular formula C15H11NO3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid.
| Compound Name | 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid |
|---|---|
| PubChem CID | 70384843 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid |
| SMILES | O=C(O)C1=C2CC=CC=C2NC(=O)c2ccccc21 |
| InChI | InChI=1S/C15H11NO3/c17-14-10-6-2-1-5-9(10)13(15(18)19)11-7-3-4-8-12(11)16-14/h1-6,8H,7H2,(H,16,17)(H,18,19) |
| InChIKey | FHRTURYWOOBRAT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |