About 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid
6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid (PubChem CID 70384843) has the molecular formula C15H11NO3
and a molecular weight of 253.26 g/mol. Its IUPAC name is 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid.
Molecular Properties
| Compound Name | 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid |
| PubChem CID | 70384843 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid |
| SMILES | O=C(O)C1=C2CC=CC=C2NC(=O)c2ccccc21 |
| InChI | InChI=1S/C15H11NO3/c17-14-10-6-2-1-5-9(10)13(15(18)19)11-7-3-4-8-12(11)16-14/h1-6,8H,7H2,(H,16,17)(H,18,19) |
| InChIKey | FHRTURYWOOBRAT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid?
The IUPAC name of 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid (CID 70384843) is 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid.
What is the SMILES notation for 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid?
The canonical SMILES for 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid is O=C(O)C1=C2CC=CC=C2NC(=O)c2ccccc21.
What is the InChIKey of 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid?
The InChIKey is FHRTURYWOOBRAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO3/c17-14-10-6-2-1-5-9(10)13(15(18)19)11-7-3-4-8-12(11)16-14/h1-6,8H,7H2,(H,16,17)(H,18,19).
What are the key properties of 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid?
6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid has a molecular weight of 253.26 g/mol, XLogP of 2.11, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-1,5-dihydrobenzo[c][1]benzazepine-11-carboxylic acid is sourced from PubChem (CID 70384843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).