C23H32N6O2 — CID 70385064
1,3-dimethyl-10-[6-(4-methylpiperazin-1-yl)hexanoyl]-5H-pyrazolo[5,4-c][1,5]benzodiazepin-4-one (PubChem CID 70385064) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 1,3-dimethyl-10-[6-(4-methylpiperazin-1-yl)hexanoyl]-5H-pyrazolo[5,4-c][1,5]benzodiazepin-4-one.
| Compound Name | 1,3-dimethyl-10-[6-(4-methylpiperazin-1-yl)hexanoyl]-5H-pyrazolo[5,4-c][1,5]benzodiazepin-4-one |
|---|---|
| PubChem CID | 70385064 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 1,3-dimethyl-10-[6-(4-methylpiperazin-1-yl)hexanoyl]-5H-pyrazolo[5,4-c][1,5]benzodiazepin-4-one |
| SMILES | Cc1nn(C)c2c1N(C(=O)CCCCCN1CCN(C)CC1)c1ccccc1NC2=O |
| InChI | InChI=1S/C23H32N6O2/c1-17-21-22(27(3)25-17)23(31)24-18-9-6-7-10-19(18)29(21)20(30)11-5-4-8-12-28-15-13-26(2)14-16-28/h6-7,9-10H,4-5,8,11-16H2,1-3H3,(H,24,31) |
| InChIKey | OFSHPSPZCCEDRN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|