About 1,2-dimethylimidazo[2,1-b][1,3]benzothiazole
1,2-dimethylimidazo[2,1-b][1,3]benzothiazole (PubChem CID 70385132) has the molecular formula C11H10N2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 1,2-dimethylimidazo[2,1-b][1,3]benzothiazole.
Molecular Properties
| Compound Name | 1,2-dimethylimidazo[2,1-b][1,3]benzothiazole |
| PubChem CID | 70385132 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 1,2-dimethylimidazo[2,1-b][1,3]benzothiazole |
| SMILES | Cc1nc2sc3ccccc3n2c1C |
| InChI | InChI=1S/C11H10N2S/c1-7-8(2)13-9-5-3-4-6-10(9)14-11(13)12-7/h3-6H,1-2H3 |
| InChIKey | DKNJQIRJRRRISE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dimethylimidazo[2,1-b][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylimidazo[2,1-b][1,3]benzothiazole?
The IUPAC name of 1,2-dimethylimidazo[2,1-b][1,3]benzothiazole (CID 70385132) is 1,2-dimethylimidazo[2,1-b][1,3]benzothiazole.
What is the SMILES notation for 1,2-dimethylimidazo[2,1-b][1,3]benzothiazole?
The canonical SMILES for 1,2-dimethylimidazo[2,1-b][1,3]benzothiazole is Cc1nc2sc3ccccc3n2c1C.
What is the InChIKey of 1,2-dimethylimidazo[2,1-b][1,3]benzothiazole?
The InChIKey is DKNJQIRJRRRISE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2S/c1-7-8(2)13-9-5-3-4-6-10(9)14-11(13)12-7/h3-6H,1-2H3.
What are the key properties of 1,2-dimethylimidazo[2,1-b][1,3]benzothiazole?
1,2-dimethylimidazo[2,1-b][1,3]benzothiazole has a molecular weight of 202.28 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylimidazo[2,1-b][1,3]benzothiazole is sourced from PubChem (CID 70385132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).