About 2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride
2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride (PubChem CID 70385167) has the molecular formula C10H19ClN2O3
and a molecular weight of 250.73 g/mol. Its IUPAC name is 2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride.
Molecular Properties
| Compound Name | 2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride |
| PubChem CID | 70385167 |
| Molecular Formula | C10H19ClN2O3 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride |
| SMILES | CC(C)COC(=O)C(C)C1NCC(=O)N1.Cl |
| InChI | InChI=1S/C10H18N2O3.ClH/c1-6(2)5-15-10(14)7(3)9-11-4-8(13)12-9;/h6-7,9,11H,4-5H2,1-3H3,(H,12,13);1H |
| InChIKey | KWQRGDLAZUSAJS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride?
The IUPAC name of 2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride (CID 70385167) is 2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride.
What is the SMILES notation for 2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride?
The canonical SMILES for 2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride is CC(C)COC(=O)C(C)C1NCC(=O)N1.Cl.
What is the InChIKey of 2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride?
The InChIKey is KWQRGDLAZUSAJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3.ClH/c1-6(2)5-15-10(14)7(3)9-11-4-8(13)12-9;/h6-7,9,11H,4-5H2,1-3H3,(H,12,13);1H.
What are the key properties of 2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride?
2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride has a molecular weight of 250.73 g/mol, XLogP of 0.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-(4-oxoimidazolidin-2-yl)propanoate;hydrochloride is sourced from PubChem (CID 70385167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).