C15H18N3O2+ — CID 7038521
1-(1H-indol-3-yl)-2-(4-methylpiperazin-4-ium-1-yl)ethane-1,2-dione (PubChem CID 7038521) has the molecular formula C15H18N3O2+ and a molecular weight of 272.33 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2-(4-methylpiperazin-4-ium-1-yl)ethane-1,2-dione.
| Compound Name | 1-(1H-indol-3-yl)-2-(4-methylpiperazin-4-ium-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 7038521 |
| Molecular Formula | C15H18N3O2+ |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-(1H-indol-3-yl)-2-(4-methylpiperazin-4-ium-1-yl)ethane-1,2-dione |
| SMILES | C[NH+]1CCN(C(=O)C(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C15H17N3O2/c1-17-6-8-18(9-7-17)15(20)14(19)12-10-16-13-5-3-2-4-11(12)13/h2-5,10,16H,6-9H2,1H3/p+1 |
| InChIKey | RVXRDSBECAJEER-UHFFFAOYSA-O |
| XLogP | -0.29 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|