About 3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one
3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one (PubChem CID 70385588) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is 3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one.
Molecular Properties
| Compound Name | 3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one |
| PubChem CID | 70385588 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one |
| SMILES | O=C1CN2CC=CC=C2N1 |
| InChI | InChI=1S/C7H8N2O/c10-7-5-9-4-2-1-3-6(9)8-7/h1-3H,4-5H2,(H,8,10) |
| InChIKey | HAVWCRDULMWFTM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one?
The IUPAC name of 3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one (CID 70385588) is 3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one.
What is the SMILES notation for 3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one?
The canonical SMILES for 3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one is O=C1CN2CC=CC=C2N1.
What is the InChIKey of 3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one?
The InChIKey is HAVWCRDULMWFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c10-7-5-9-4-2-1-3-6(9)8-7/h1-3H,4-5H2,(H,8,10).
What are the key properties of 3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one?
3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one has a molecular weight of 136.15 g/mol, XLogP of -0.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydro-1H-imidazo[1,2-a]pyridin-2-one is sourced from PubChem (CID 70385588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).