About 5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid
5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid (PubChem CID 70385691) has the molecular formula C8H6O5
and a molecular weight of 182.13 g/mol. Its IUPAC name is 5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid |
| PubChem CID | 70385691 |
| Molecular Formula | C8H6O5 |
| Molecular Weight | 182.13 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid |
| SMILES | O=C(O)C1=CC=C(C(=O)O)C(=O)C1 |
| InChI | InChI=1S/C8H6O5/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-2H,3H2,(H,10,11)(H,12,13) |
| InChIKey | KUBLNZHMWZIFMW-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.13 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid?
The IUPAC name of 5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid (CID 70385691) is 5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid.
What is the SMILES notation for 5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid?
The canonical SMILES for 5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid is O=C(O)C1=CC=C(C(=O)O)C(=O)C1.
What is the InChIKey of 5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid?
The InChIKey is KUBLNZHMWZIFMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O5/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-2H,3H2,(H,10,11)(H,12,13).
What are the key properties of 5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid?
5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid has a molecular weight of 182.13 g/mol, XLogP of -0.02, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxocyclohexa-1,3-diene-1,4-dicarboxylic acid is sourced from PubChem (CID 70385691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).