About 2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine
2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine (PubChem CID 70385757) has the molecular formula C15H13N3O
and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine.
Molecular Properties
| Compound Name | 2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine |
| PubChem CID | 70385757 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine |
| SMILES | C1=CC2=NN=C(N3CCc4ccccc4O3)C2C=C1 |
| InChI | InChI=1S/C15H13N3O/c1-4-8-14-11(5-1)9-10-18(19-14)15-12-6-2-3-7-13(12)16-17-15/h1-8,12H,9-10H2 |
| InChIKey | LPOQUCXPHUXGDM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine?
The IUPAC name of 2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine (CID 70385757) is 2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine.
What is the SMILES notation for 2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine?
The canonical SMILES for 2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine is C1=CC2=NN=C(N3CCc4ccccc4O3)C2C=C1.
What is the InChIKey of 2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine?
The InChIKey is LPOQUCXPHUXGDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O/c1-4-8-14-11(5-1)9-10-18(19-14)15-12-6-2-3-7-13(12)16-17-15/h1-8,12H,9-10H2.
What are the key properties of 2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine?
2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine has a molecular weight of 251.29 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3aH-indazol-3-yl)-3,4-dihydro-1,2-benzoxazine is sourced from PubChem (CID 70385757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).