About tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate
tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate (PubChem CID 70385774) has the molecular formula C54H104O3
and a molecular weight of 801.42 g/mol. Its IUPAC name is tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate |
| PubChem CID | 70385774 |
| Molecular Formula | C54H104O3 |
| Molecular Weight | 801.42 g/mol |
| Exact Mass | 800.80 |
| IUPAC Name | tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate |
| SMILES | C1CCCCCCCCCCC1.C1CCCCCCCCCCC1.C1CCCCCCCCCCC1.C=C(C)C(=O)OCC1(CO)CCCCCCCCCCC1 |
| InChI | InChI=1S/C18H32O3.3C12H24/c1-16(2)17(20)21-15-18(14-19)12-10-8-6-4-3-5-7-9-11-13-18;3*1-2-4-6-8-10-12-11-9-7-5-3-1/h19H,1,3-15H2,2H3;3*1-12H2 |
| InChIKey | LKAKWTPRVFEUQH-UHFFFAOYSA-N |
| XLogP | 18.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 801.42 |
| LogP ≤ 5 | 18.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate?
The IUPAC name of tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate (CID 70385774) is tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate.
What is the SMILES notation for tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate?
The canonical SMILES for tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate is C1CCCCCCCCCCC1.C1CCCCCCCCCCC1.C1CCCCCCCCCCC1.C=C(C)C(=O)OCC1(CO)CCCCCCCCCCC1.
What is the InChIKey of tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate?
The InChIKey is LKAKWTPRVFEUQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O3.3C12H24/c1-16(2)17(20)21-15-18(14-19)12-10-8-6-4-3-5-7-9-11-13-18;3*1-2-4-6-8-10-12-11-9-7-5-3-1/h19H,1,3-15H2,2H3;3*1-12H2.
What are the key properties of tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate?
tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate has a molecular weight of 801.42 g/mol, XLogP of 18.43, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris(cyclododecane);[1-(hydroxymethyl)cyclododecyl]methyl 2-methylprop-2-enoate is sourced from PubChem (CID 70385774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).