(7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid

C9H14O5 — CID 70385905

IUPAC(7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid
SMILESO=C(O)[C@@H]1CC2(CC[C@@H]1O)OCCO2
InChIInChI=1S/C9H14O5/c10-7-1-2-9(13-3-4-14-9)5-6(7)8(11)12/h6-7,10H,1-5H2,(H,11,12)/t6-,7+/m1/s1
InChIKeyHOCUQARONFZBAA-RQJHMYQMSA-N
MW202.21 g/mol
LogP-0.02
Rot. Bonds1

About (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid

(7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid (PubChem CID 70385905) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid.

Molecular Properties

Compound Name(7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid
PubChem CID70385905
Molecular FormulaC9H14O5
Molecular Weight202.21 g/mol
Exact Mass202.08
IUPAC Name(7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid
SMILESO=C(O)[C@@H]1CC2(CC[C@@H]1O)OCCO2
InChIInChI=1S/C9H14O5/c10-7-1-2-9(13-3-4-14-9)5-6(7)8(11)12/h6-7,10H,1-5H2,(H,11,12)/t6-,7+/m1/s1
InChIKeyHOCUQARONFZBAA-RQJHMYQMSA-N
XLogP-0.02
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.21
LogP ≤ 5-0.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid?
The IUPAC name of (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid (CID 70385905) is (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid.
What is the SMILES notation for (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid?
The canonical SMILES for (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid is O=C(O)[C@@H]1CC2(CC[C@@H]1O)OCCO2.
What is the InChIKey of (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid?
The InChIKey is HOCUQARONFZBAA-RQJHMYQMSA-N. The full InChI is InChI=1S/C9H14O5/c10-7-1-2-9(13-3-4-14-9)5-6(7)8(11)12/h6-7,10H,1-5H2,(H,11,12)/t6-,7+/m1/s1.
What are the key properties of (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid?
(7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid has a molecular weight of 202.21 g/mol, XLogP of -0.02, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid is sourced from PubChem (CID 70385905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).