About (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid
(7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid (PubChem CID 70385905) has the molecular formula C9H14O5
and a molecular weight of 202.21 g/mol. Its IUPAC name is (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid.
Molecular Properties
| Compound Name | (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid |
| PubChem CID | 70385905 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC2(CC[C@@H]1O)OCCO2 |
| InChI | InChI=1S/C9H14O5/c10-7-1-2-9(13-3-4-14-9)5-6(7)8(11)12/h6-7,10H,1-5H2,(H,11,12)/t6-,7+/m1/s1 |
| InChIKey | HOCUQARONFZBAA-RQJHMYQMSA-N |
| XLogP | -0.02 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid?
The IUPAC name of (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid (CID 70385905) is (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid.
What is the SMILES notation for (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid?
The canonical SMILES for (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid is O=C(O)[C@@H]1CC2(CC[C@@H]1O)OCCO2.
What is the InChIKey of (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid?
The InChIKey is HOCUQARONFZBAA-RQJHMYQMSA-N. The full InChI is InChI=1S/C9H14O5/c10-7-1-2-9(13-3-4-14-9)5-6(7)8(11)12/h6-7,10H,1-5H2,(H,11,12)/t6-,7+/m1/s1.
What are the key properties of (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid?
(7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid has a molecular weight of 202.21 g/mol, XLogP of -0.02, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7R,8S)-8-hydroxy-1,4-dioxaspiro[4.5]decane-7-carboxylic acid is sourced from PubChem (CID 70385905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).