About ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate
ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate (PubChem CID 70386325) has the molecular formula C14H22O8
and a molecular weight of 318.32 g/mol. Its IUPAC name is ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate.
Molecular Properties
| Compound Name | ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate |
| PubChem CID | 70386325 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate |
| SMILES | CCOC(=O)CC1(CC)OC(O)C=CC1=O.CCOC(=O)O |
| InChI | InChI=1S/C11H16O5.C3H6O3/c1-3-11(7-10(14)15-4-2)8(12)5-6-9(13)16-11;1-2-6-3(4)5/h5-6,9,13H,3-4,7H2,1-2H3;2H2,1H3,(H,4,5) |
| InChIKey | ANUDHJSNRBUYJC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate?
The IUPAC name of ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate (CID 70386325) is ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate.
What is the SMILES notation for ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate?
The canonical SMILES for ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate is CCOC(=O)CC1(CC)OC(O)C=CC1=O.CCOC(=O)O.
What is the InChIKey of ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate?
The InChIKey is ANUDHJSNRBUYJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O5.C3H6O3/c1-3-11(7-10(14)15-4-2)8(12)5-6-9(13)16-11;1-2-6-3(4)5/h5-6,9,13H,3-4,7H2,1-2H3;2H2,1H3,(H,4,5).
What are the key properties of ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate?
ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate has a molecular weight of 318.32 g/mol, XLogP of 1.26, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(6-ethyl-2-hydroxy-5-oxo-2H-pyran-6-yl)acetate;ethyl hydrogen carbonate is sourced from PubChem (CID 70386325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).