C17H20OS — CID 70386917
4-(4-pentylsulfanylphenyl)phenol (PubChem CID 70386917) has the molecular formula C17H20OS and a molecular weight of 272.41 g/mol. Its IUPAC name is 4-(4-pentylsulfanylphenyl)phenol.
| Compound Name | 4-(4-pentylsulfanylphenyl)phenol |
|---|---|
| PubChem CID | 70386917 |
| Molecular Formula | C17H20OS |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 4-(4-pentylsulfanylphenyl)phenol |
| SMILES | CCCCCSc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C17H20OS/c1-2-3-4-13-19-17-11-7-15(8-12-17)14-5-9-16(18)10-6-14/h5-12,18H,2-4,13H2,1H3 |
| InChIKey | MLKHTSPYEHZXDN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|