About 2-(cyclohexa-2,4-dien-1-ylamino)acetamide
2-(cyclohexa-2,4-dien-1-ylamino)acetamide (PubChem CID 70387720) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-(cyclohexa-2,4-dien-1-ylamino)acetamide.
Molecular Properties
| Compound Name | 2-(cyclohexa-2,4-dien-1-ylamino)acetamide |
| PubChem CID | 70387720 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-(cyclohexa-2,4-dien-1-ylamino)acetamide |
| SMILES | NC(=O)CNC1C=CC=CC1 |
| InChI | InChI=1S/C8H12N2O/c9-8(11)6-10-7-4-2-1-3-5-7/h1-4,7,10H,5-6H2,(H2,9,11) |
| InChIKey | CVLJPAXFKMBNJD-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclohexa-2,4-dien-1-ylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexa-2,4-dien-1-ylamino)acetamide?
The IUPAC name of 2-(cyclohexa-2,4-dien-1-ylamino)acetamide (CID 70387720) is 2-(cyclohexa-2,4-dien-1-ylamino)acetamide.
What is the SMILES notation for 2-(cyclohexa-2,4-dien-1-ylamino)acetamide?
The canonical SMILES for 2-(cyclohexa-2,4-dien-1-ylamino)acetamide is NC(=O)CNC1C=CC=CC1.
What is the InChIKey of 2-(cyclohexa-2,4-dien-1-ylamino)acetamide?
The InChIKey is CVLJPAXFKMBNJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c9-8(11)6-10-7-4-2-1-3-5-7/h1-4,7,10H,5-6H2,(H2,9,11).
What are the key properties of 2-(cyclohexa-2,4-dien-1-ylamino)acetamide?
2-(cyclohexa-2,4-dien-1-ylamino)acetamide has a molecular weight of 152.20 g/mol, XLogP of -0.05, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexa-2,4-dien-1-ylamino)acetamide is sourced from PubChem (CID 70387720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).