C22H25N3O6 — CID 70388081
N-(1-butyl-4,4-dimethyl-7-nitro-2-oxo-3,1-benzoxazin-6-yl)-4-methoxybenzamide (PubChem CID 70388081) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-(1-butyl-4,4-dimethyl-7-nitro-2-oxo-3,1-benzoxazin-6-yl)-4-methoxybenzamide.
| Compound Name | N-(1-butyl-4,4-dimethyl-7-nitro-2-oxo-3,1-benzoxazin-6-yl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 70388081 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-(1-butyl-4,4-dimethyl-7-nitro-2-oxo-3,1-benzoxazin-6-yl)-4-methoxybenzamide |
| SMILES | CCCCN1C(=O)OC(C)(C)c2cc(NC(=O)c3ccc(OC)cc3)c([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C22H25N3O6/c1-5-6-11-24-18-13-19(25(28)29)17(12-16(18)22(2,3)31-21(24)27)23-20(26)14-7-9-15(30-4)10-8-14/h7-10,12-13H,5-6,11H2,1-4H3,(H,23,26) |
| InChIKey | OZUAFLZOOZULIU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|