About 2H-isoquinoline-6,6-diol
2H-isoquinoline-6,6-diol (PubChem CID 70388151) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2H-isoquinoline-6,6-diol.
Molecular Properties
| Compound Name | 2H-isoquinoline-6,6-diol |
| PubChem CID | 70388151 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 2H-isoquinoline-6,6-diol |
| SMILES | OC1(O)C=CC2=CNC=CC2=C1 |
| InChI | InChI=1S/C9H9NO2/c11-9(12)3-1-8-6-10-4-2-7(8)5-9/h1-6,10-12H |
| InChIKey | CACZFVIJGLWTLV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2H-isoquinoline-6,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-isoquinoline-6,6-diol?
The IUPAC name of 2H-isoquinoline-6,6-diol (CID 70388151) is 2H-isoquinoline-6,6-diol.
What is the SMILES notation for 2H-isoquinoline-6,6-diol?
The canonical SMILES for 2H-isoquinoline-6,6-diol is OC1(O)C=CC2=CNC=CC2=C1.
What is the InChIKey of 2H-isoquinoline-6,6-diol?
The InChIKey is CACZFVIJGLWTLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c11-9(12)3-1-8-6-10-4-2-7(8)5-9/h1-6,10-12H.
What are the key properties of 2H-isoquinoline-6,6-diol?
2H-isoquinoline-6,6-diol has a molecular weight of 163.18 g/mol, XLogP of 0.16, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-isoquinoline-6,6-diol is sourced from PubChem (CID 70388151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).