About 2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid
2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid (PubChem CID 70388811) has the molecular formula C23H36O3
and a molecular weight of 360.54 g/mol. Its IUPAC name is 2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid.
Molecular Properties
| Compound Name | 2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid |
| PubChem CID | 70388811 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | 2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid |
| SMILES | C=CCC(OCC1CCC(C2CCC(CC=C)CC2)CC1)=C(C)C(=O)O |
| InChI | InChI=1S/C23H36O3/c1-4-6-18-8-12-20(13-9-18)21-14-10-19(11-15-21)16-26-22(7-5-2)17(3)23(24)25/h4-5,18-21H,1-2,6-16H2,3H3,(H,24,25) |
| InChIKey | VFAUVNLCUOQVAU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid?
The IUPAC name of 2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid (CID 70388811) is 2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid.
What is the SMILES notation for 2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid?
The canonical SMILES for 2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid is C=CCC(OCC1CCC(C2CCC(CC=C)CC2)CC1)=C(C)C(=O)O.
What is the InChIKey of 2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid?
The InChIKey is VFAUVNLCUOQVAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H36O3/c1-4-6-18-8-12-20(13-9-18)21-14-10-19(11-15-21)16-26-22(7-5-2)17(3)23(24)25/h4-5,18-21H,1-2,6-16H2,3H3,(H,24,25).
What are the key properties of 2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid?
2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid has a molecular weight of 360.54 g/mol, XLogP of 6.13, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[[4-(4-prop-2-enylcyclohexyl)cyclohexyl]methoxy]hexa-2,5-dienoic acid is sourced from PubChem (CID 70388811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).