About bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride
bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride (PubChem CID 70389056) has the molecular formula C12H24Cl2N6
and a molecular weight of 323.27 g/mol. Its IUPAC name is bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride.
Molecular Properties
| Compound Name | bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride |
| PubChem CID | 70389056 |
| Molecular Formula | C12H24Cl2N6 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride |
| SMILES | CC(CN1C=NCC1)/N=N/C(C)CN1C=NCC1.Cl.Cl |
| InChI | InChI=1S/C12H22N6.2ClH/c1-11(7-17-5-3-13-9-17)15-16-12(2)8-18-6-4-14-10-18;;/h9-12H,3-8H2,1-2H3;2*1H/b16-15+;; |
| InChIKey | DSVOTYDLMYFLFQ-VRZXRVJBSA-N |
| XLogP | 1.75 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride?
The IUPAC name of bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride (CID 70389056) is bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride.
What is the SMILES notation for bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride?
The canonical SMILES for bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride is CC(CN1C=NCC1)/N=N/C(C)CN1C=NCC1.Cl.Cl.
What is the InChIKey of bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride?
The InChIKey is DSVOTYDLMYFLFQ-VRZXRVJBSA-N. The full InChI is InChI=1S/C12H22N6.2ClH/c1-11(7-17-5-3-13-9-17)15-16-12(2)8-18-6-4-14-10-18;;/h9-12H,3-8H2,1-2H3;2*1H/b16-15+;;.
What are the key properties of bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride?
bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride has a molecular weight of 323.27 g/mol, XLogP of 1.75, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[1-(4,5-dihydroimidazol-1-yl)propan-2-yl]diazene;dihydrochloride is sourced from PubChem (CID 70389056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).