C22H39F3O2Si — CID 70389593
3-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-2-prop-2-enylcyclopent-3-en-1-ol (PubChem CID 70389593) has the molecular formula C22H39F3O2Si and a molecular weight of 420.63 g/mol. Its IUPAC name is 3-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-2-prop-2-enylcyclopent-3-en-1-ol.
| Compound Name | 3-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-2-prop-2-enylcyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 70389593 |
| Molecular Formula | C22H39F3O2Si |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 3-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-2-prop-2-enylcyclopent-3-en-1-ol |
| SMILES | C=CCC1C(CCC(CCCCC(F)(F)F)O[Si](C)(C)C(C)(C)C)=CCC1O |
| InChI | InChI=1S/C22H39F3O2Si/c1-7-10-19-17(13-15-20(19)26)12-14-18(11-8-9-16-22(23,24)25)27-28(5,6)21(2,3)4/h7,13,18-20,26H,1,8-12,14-16H2,2-6H3 |
| InChIKey | HFPBPLKIYASLJV-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|