About 4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine
4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine (PubChem CID 703896) has the molecular formula C18H16N4S
and a molecular weight of 320.42 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine |
| PubChem CID | 703896 |
| Molecular Formula | C18H16N4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine |
| SMILES | Cc1ccc(-c2csc3ncnc(-n4nc(C)cc4C)c23)cc1 |
| InChI | InChI=1S/C18H16N4S/c1-11-4-6-14(7-5-11)15-9-23-18-16(15)17(19-10-20-18)22-13(3)8-12(2)21-22/h4-10H,1-3H3 |
| InChIKey | CKHYFQBXYGJKAK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine?
The IUPAC name of 4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine (CID 703896) is 4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine.
What is the SMILES notation for 4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine?
The canonical SMILES for 4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine is Cc1ccc(-c2csc3ncnc(-n4nc(C)cc4C)c23)cc1.
What is the InChIKey of 4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine?
The InChIKey is CKHYFQBXYGJKAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4S/c1-11-4-6-14(7-5-11)15-9-23-18-16(15)17(19-10-20-18)22-13(3)8-12(2)21-22/h4-10H,1-3H3.
What are the key properties of 4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine?
4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine has a molecular weight of 320.42 g/mol, XLogP of 4.47, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylpyrazol-1-yl)-5-(4-methylphenyl)thieno[2,3-d]pyrimidine is sourced from PubChem (CID 703896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).