C20H23N5O3 — CID 70389693
4-[amino(benzyl)amino]-1-(3,4-diethoxyphenyl)-1,3,5-triazin-2-one (PubChem CID 70389693) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-[amino(benzyl)amino]-1-(3,4-diethoxyphenyl)-1,3,5-triazin-2-one.
| Compound Name | 4-[amino(benzyl)amino]-1-(3,4-diethoxyphenyl)-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 70389693 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-[amino(benzyl)amino]-1-(3,4-diethoxyphenyl)-1,3,5-triazin-2-one |
| SMILES | CCOc1ccc(-n2cnc(N(N)Cc3ccccc3)nc2=O)cc1OCC |
| InChI | InChI=1S/C20H23N5O3/c1-3-27-17-11-10-16(12-18(17)28-4-2)24-14-22-19(23-20(24)26)25(21)13-15-8-6-5-7-9-15/h5-12,14H,3-4,13,21H2,1-2H3 |
| InChIKey | GSNYWSUREWUTSG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|