C16H15N5O — CID 70389749
4-(N-aminoanilino)-1-benzyl-1,3,5-triazin-2-one (PubChem CID 70389749) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is 4-(N-aminoanilino)-1-benzyl-1,3,5-triazin-2-one.
| Compound Name | 4-(N-aminoanilino)-1-benzyl-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 70389749 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4-(N-aminoanilino)-1-benzyl-1,3,5-triazin-2-one |
| SMILES | NN(c1ccccc1)c1ncn(Cc2ccccc2)c(=O)n1 |
| InChI | InChI=1S/C16H15N5O/c17-21(14-9-5-2-6-10-14)15-18-12-20(16(22)19-15)11-13-7-3-1-4-8-13/h1-10,12H,11,17H2 |
| InChIKey | CUQDUUXHAJYYKM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|