C19H21N5O — CID 70389751
4-(N-aminoanilino)-1-(2,6-dimethylphenyl)-6-ethyl-1,3,5-triazin-2-one (PubChem CID 70389751) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 4-(N-aminoanilino)-1-(2,6-dimethylphenyl)-6-ethyl-1,3,5-triazin-2-one.
| Compound Name | 4-(N-aminoanilino)-1-(2,6-dimethylphenyl)-6-ethyl-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 70389751 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-(N-aminoanilino)-1-(2,6-dimethylphenyl)-6-ethyl-1,3,5-triazin-2-one |
| SMILES | CCc1nc(N(N)c2ccccc2)nc(=O)n1-c1c(C)cccc1C |
| InChI | InChI=1S/C19H21N5O/c1-4-16-21-18(24(20)15-11-6-5-7-12-15)22-19(25)23(16)17-13(2)9-8-10-14(17)3/h5-12H,4,20H2,1-3H3 |
| InChIKey | KQCGNEADWJWMPU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|