About 3-methylbenzene-1,2-dithiol;phenol
3-methylbenzene-1,2-dithiol;phenol (PubChem CID 70389752) has the molecular formula C19H20O2S2
and a molecular weight of 344.50 g/mol. Its IUPAC name is 3-methylbenzene-1,2-dithiol;phenol.
Molecular Properties
| Compound Name | 3-methylbenzene-1,2-dithiol;phenol |
| PubChem CID | 70389752 |
| Molecular Formula | C19H20O2S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3-methylbenzene-1,2-dithiol;phenol |
| SMILES | Cc1cccc(S)c1S.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C7H8S2.2C6H6O/c1-5-3-2-4-6(8)7(5)9;2*7-6-4-2-1-3-5-6/h2-4,8-9H,1H3;2*1-5,7H |
| InChIKey | WDABOACCXSLILN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbenzene-1,2-dithiol;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbenzene-1,2-dithiol;phenol?
The IUPAC name of 3-methylbenzene-1,2-dithiol;phenol (CID 70389752) is 3-methylbenzene-1,2-dithiol;phenol.
What is the SMILES notation for 3-methylbenzene-1,2-dithiol;phenol?
The canonical SMILES for 3-methylbenzene-1,2-dithiol;phenol is Cc1cccc(S)c1S.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of 3-methylbenzene-1,2-dithiol;phenol?
The InChIKey is WDABOACCXSLILN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8S2.2C6H6O/c1-5-3-2-4-6(8)7(5)9;2*7-6-4-2-1-3-5-6/h2-4,8-9H,1H3;2*1-5,7H.
What are the key properties of 3-methylbenzene-1,2-dithiol;phenol?
3-methylbenzene-1,2-dithiol;phenol has a molecular weight of 344.50 g/mol, XLogP of 5.36, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbenzene-1,2-dithiol;phenol is sourced from PubChem (CID 70389752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).