C26H45F3O4Si — CID 70389844
(Z)-7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-hydroxycyclopent-2-en-1-yl]hept-5-enoic acid (PubChem CID 70389844) has the molecular formula C26H45F3O4Si and a molecular weight of 506.72 g/mol. Its IUPAC name is (Z)-7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-hydroxycyclopent-2-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-hydroxycyclopent-2-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70389844 |
| Molecular Formula | C26H45F3O4Si |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | (Z)-7-[(1R)-2-[3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooctyl]-5-hydroxycyclopent-2-en-1-yl]hept-5-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCCCC(F)(F)F)CCC1=CCC(O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C26H45F3O4Si/c1-25(2,3)34(4,5)33-21(12-10-11-19-26(27,28)29)17-15-20-16-18-23(30)22(20)13-8-6-7-9-14-24(31)32/h6,8,16,21-23,30H,7,9-15,17-19H2,1-5H3,(H,31,32)/b8-6-/t21?,22-,23?/m1/s1 |
| InChIKey | BXKUEKFCABRXIX-RWLQJUNYSA-N |
| XLogP | 7.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|