C20H29F3O4 — CID 70389932
(Z)-7-[(1R)-5-oxo-2-(8,8,8-trifluoro-3-hydroxyoctyl)cyclopent-2-en-1-yl]hept-5-enoic acid (PubChem CID 70389932) has the molecular formula C20H29F3O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is (Z)-7-[(1R)-5-oxo-2-(8,8,8-trifluoro-3-hydroxyoctyl)cyclopent-2-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R)-5-oxo-2-(8,8,8-trifluoro-3-hydroxyoctyl)cyclopent-2-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70389932 |
| Molecular Formula | C20H29F3O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (Z)-7-[(1R)-5-oxo-2-(8,8,8-trifluoro-3-hydroxyoctyl)cyclopent-2-en-1-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1C(=O)CC=C1CCC(O)CCCCC(F)(F)F |
| InChI | InChI=1S/C20H29F3O4/c21-20(22,23)14-6-5-7-16(24)12-10-15-11-13-18(25)17(15)8-3-1-2-4-9-19(26)27/h1,3,11,16-17,24H,2,4-10,12-14H2,(H,26,27)/b3-1-/t16?,17-/m1/s1 |
| InChIKey | MTUKNOXDVYKSPK-YTMHQBFRSA-N |
| XLogP | 4.97 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|