About bis(ethanediimidamide);toluene
bis(ethanediimidamide);toluene (PubChem CID 70390031) has the molecular formula C11H20N8
and a molecular weight of 264.34 g/mol. Its IUPAC name is bis(ethanediimidamide);toluene.
Molecular Properties
| Compound Name | bis(ethanediimidamide);toluene |
| PubChem CID | 70390031 |
| Molecular Formula | C11H20N8 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | bis(ethanediimidamide);toluene |
| SMILES | Cc1ccccc1.[H]/N=C(N)/C(N)=N/[H].[H]/N=C(N)/C(N)=N/[H] |
| InChI | InChI=1S/C7H8.2C2H6N4/c1-7-5-3-2-4-6-7;2*3-1(4)2(5)6/h2-6H,1H3;2*(H3,3,4)(H3,5,6) |
| InChIKey | IJEBIDQDUWCXML-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 199.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze bis(ethanediimidamide);toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(ethanediimidamide);toluene?
The IUPAC name of bis(ethanediimidamide);toluene (CID 70390031) is bis(ethanediimidamide);toluene.
What is the SMILES notation for bis(ethanediimidamide);toluene?
The canonical SMILES for bis(ethanediimidamide);toluene is Cc1ccccc1.[H]/N=C(N)/C(N)=N/[H].[H]/N=C(N)/C(N)=N/[H].
What is the InChIKey of bis(ethanediimidamide);toluene?
The InChIKey is IJEBIDQDUWCXML-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.2C2H6N4/c1-7-5-3-2-4-6-7;2*3-1(4)2(5)6/h2-6H,1H3;2*(H3,3,4)(H3,5,6).
What are the key properties of bis(ethanediimidamide);toluene?
bis(ethanediimidamide);toluene has a molecular weight of 264.34 g/mol, XLogP of -0.29, 0 rotatable bonds, 8 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(ethanediimidamide);toluene is sourced from PubChem (CID 70390031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).