C17H17N5O3 — CID 70390389
4-(N-aminoanilino)-1-(3,4-dimethoxyphenyl)-1,3,5-triazin-2-one (PubChem CID 70390389) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 4-(N-aminoanilino)-1-(3,4-dimethoxyphenyl)-1,3,5-triazin-2-one.
| Compound Name | 4-(N-aminoanilino)-1-(3,4-dimethoxyphenyl)-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 70390389 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-(N-aminoanilino)-1-(3,4-dimethoxyphenyl)-1,3,5-triazin-2-one |
| SMILES | COc1ccc(-n2cnc(N(N)c3ccccc3)nc2=O)cc1OC |
| InChI | InChI=1S/C17H17N5O3/c1-24-14-9-8-13(10-15(14)25-2)21-11-19-16(20-17(21)23)22(18)12-6-4-3-5-7-12/h3-11H,18H2,1-2H3 |
| InChIKey | JPPXPCKWZTVZNY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|