C22H27N3 — CID 70390797
5-(1-methylpiperidin-4-yl)-1,8-diazatetracyclo[8.7.1.02,7.014,18]octadeca-2,6,8,10(18),14,16-hexaene (PubChem CID 70390797) has the molecular formula C22H27N3 and a molecular weight of 333.48 g/mol. Its IUPAC name is 5-(1-methylpiperidin-4-yl)-1,8-diazatetracyclo[8.7.1.02,7.014,18]octadeca-2,6,8,10(18),14,16-hexaene.
| Compound Name | 5-(1-methylpiperidin-4-yl)-1,8-diazatetracyclo[8.7.1.02,7.014,18]octadeca-2,6,8,10(18),14,16-hexaene |
|---|---|
| PubChem CID | 70390797 |
| Molecular Formula | C22H27N3 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 5-(1-methylpiperidin-4-yl)-1,8-diazatetracyclo[8.7.1.02,7.014,18]octadeca-2,6,8,10(18),14,16-hexaene |
| SMILES | CN1CCC(C2C=C3N=CC4=C5C(=CC=CN5C3=CC2)CCC4)CC1 |
| InChI | InChI=1S/C22H27N3/c1-24-12-9-16(10-13-24)18-7-8-21-20(14-18)23-15-19-5-2-4-17-6-3-11-25(21)22(17)19/h3,6,8,11,14-16,18H,2,4-5,7,9-10,12-13H2,1H3 |
| InChIKey | YKLPLASOEZDKIV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |