C25H35BrN2O2 — CID 70391287
2-bromo-3-methyl-2-[4-(5-nonylpyrimidin-2-yl)phenyl]pentanoic acid (PubChem CID 70391287) has the molecular formula C25H35BrN2O2 and a molecular weight of 475.47 g/mol. Its IUPAC name is 2-bromo-3-methyl-2-[4-(5-nonylpyrimidin-2-yl)phenyl]pentanoic acid.
| Compound Name | 2-bromo-3-methyl-2-[4-(5-nonylpyrimidin-2-yl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 70391287 |
| Molecular Formula | C25H35BrN2O2 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 2-bromo-3-methyl-2-[4-(5-nonylpyrimidin-2-yl)phenyl]pentanoic acid |
| SMILES | CCCCCCCCCc1cnc(-c2ccc(C(Br)(C(=O)O)C(C)CC)cc2)nc1 |
| InChI | InChI=1S/C25H35BrN2O2/c1-4-6-7-8-9-10-11-12-20-17-27-23(28-18-20)21-13-15-22(16-14-21)25(26,24(29)30)19(3)5-2/h13-19H,4-12H2,1-3H3,(H,29,30) |
| InChIKey | DGAYYBFMIDNQFX-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|