C9H13ClN2O — CID 70391291
3-(3-chlorophenoxy)propane-1,2-diamine (PubChem CID 70391291) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is 3-(3-chlorophenoxy)propane-1,2-diamine.
| Compound Name | 3-(3-chlorophenoxy)propane-1,2-diamine |
|---|---|
| PubChem CID | 70391291 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 3-(3-chlorophenoxy)propane-1,2-diamine |
| SMILES | NCC(N)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H13ClN2O/c10-7-2-1-3-9(4-7)13-6-8(12)5-11/h1-4,8H,5-6,11-12H2 |
| InChIKey | NESBMHPVBONPOA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |