About 1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide
1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide (PubChem CID 70391387) has the molecular formula C11H20BrN3O
and a molecular weight of 290.20 g/mol. Its IUPAC name is 1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide.
Molecular Properties
| Compound Name | 1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide |
| PubChem CID | 70391387 |
| Molecular Formula | C11H20BrN3O |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide |
| SMILES | CCc1n(N)cc[n+]1CC(=O)C(C)(C)C.[Br-] |
| InChI | InChI=1S/C11H20N3O.BrH/c1-5-10-13(6-7-14(10)12)8-9(15)11(2,3)4;/h6-7H,5,8,12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | WZCVTRCOICCHLZ-UHFFFAOYSA-M |
| XLogP | -2.33 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide?
The IUPAC name of 1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide (CID 70391387) is 1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide.
What is the SMILES notation for 1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide?
The canonical SMILES for 1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide is CCc1n(N)cc[n+]1CC(=O)C(C)(C)C.[Br-].
What is the InChIKey of 1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide?
The InChIKey is WZCVTRCOICCHLZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H20N3O.BrH/c1-5-10-13(6-7-14(10)12)8-9(15)11(2,3)4;/h6-7H,5,8,12H2,1-4H3;1H/q+1;/p-1.
What are the key properties of 1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide?
1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide has a molecular weight of 290.20 g/mol, XLogP of -2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-2-ethylimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide is sourced from PubChem (CID 70391387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).