About [(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium
[(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium (PubChem CID 7039155) has the molecular formula C7H16Br2N+
and a molecular weight of 274.02 g/mol. Its IUPAC name is [(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium.
Molecular Properties
| Compound Name | [(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium |
| PubChem CID | 7039155 |
| Molecular Formula | C7H16Br2N+ |
| Molecular Weight | 274.02 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | [(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium |
| SMILES | CC(C)C[NH2+]C[C@@H](Br)CBr |
| InChI | InChI=1S/C7H15Br2N/c1-6(2)4-10-5-7(9)3-8/h6-7,10H,3-5H2,1-2H3/p+1/t7-/m0/s1 |
| InChIKey | VFEPZGMZLVSRCX-ZETCQYMHSA-O |
| XLogP | 1.36 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.02 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium?
The IUPAC name of [(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium (CID 7039155) is [(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium.
What is the SMILES notation for [(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium?
The canonical SMILES for [(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium is CC(C)C[NH2+]C[C@@H](Br)CBr.
What is the InChIKey of [(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium?
The InChIKey is VFEPZGMZLVSRCX-ZETCQYMHSA-O. The full InChI is InChI=1S/C7H15Br2N/c1-6(2)4-10-5-7(9)3-8/h6-7,10H,3-5H2,1-2H3/p+1/t7-/m0/s1.
What are the key properties of [(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium?
[(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium has a molecular weight of 274.02 g/mol, XLogP of 1.36, 5 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2,3-dibromopropyl]-(2-methylpropyl)azanium is sourced from PubChem (CID 7039155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).