C15H21N6NaO9S — CID 70391651
sodium 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-(methylamino)-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonate (PubChem CID 70391651) has the molecular formula C15H21N6NaO9S and a molecular weight of 484.42 g/mol. Its IUPAC name is sodium 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-(methylamino)-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonate.
| Compound Name | sodium 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-(methylamino)-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 70391651 |
| Molecular Formula | C15H21N6NaO9S |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | sodium 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-(methylamino)-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonate |
| SMILES | CCN1CCN(C(=O)NC(CC(=O)NC)C(=O)NC2CN(S(=O)(=O)[O-])C2=O)C(=O)C1=O.[Na+] |
| InChI | InChI=1S/C15H22N6O9S.Na/c1-3-19-4-5-20(14(26)13(19)25)15(27)18-8(6-10(22)16-2)11(23)17-9-7-21(12(9)24)31(28,29)30;/h8-9H,3-7H2,1-2H3,(H,16,22)(H,17,23)(H,18,27)(H,28,29,30);/q;+1/p-1 |
| InChIKey | JPNPBZGFYORRLQ-UHFFFAOYSA-M |
| XLogP | -7.32 |
| TPSA | 205.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | -7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|