About cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate
cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate (PubChem CID 70391685) has the molecular formula C12H21NO5
and a molecular weight of 259.30 g/mol. Its IUPAC name is cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate.
Molecular Properties
| Compound Name | cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate |
| PubChem CID | 70391685 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate |
| SMILES | CC([C@H]1CC(=O)C[C@H]1C)[N+](=O)[O-].CCOC(C)=O |
| InChI | InChI=1S/C8H13NO3.C4H8O2/c1-5-3-7(10)4-8(5)6(2)9(11)12;1-3-6-4(2)5/h5-6,8H,3-4H2,1-2H3;3H2,1-2H3/t5-,6?,8+;/m1./s1 |
| InChIKey | HPRYQBHSKSBPOT-YSPYFHHRSA-N |
| XLogP | 1.84 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate?
The IUPAC name of cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate (CID 70391685) is cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate.
What is the SMILES notation for cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate?
The canonical SMILES for cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate is CC([C@H]1CC(=O)C[C@H]1C)[N+](=O)[O-].CCOC(C)=O.
What is the InChIKey of cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate?
The InChIKey is HPRYQBHSKSBPOT-YSPYFHHRSA-N. The full InChI is InChI=1S/C8H13NO3.C4H8O2/c1-5-3-7(10)4-8(5)6(2)9(11)12;1-3-6-4(2)5/h5-6,8H,3-4H2,1-2H3;3H2,1-2H3/t5-,6?,8+;/m1./s1.
What are the key properties of cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate?
cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate has a molecular weight of 259.30 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(3R,4S)-3-methyl-4-(1-nitroethyl)cyclopentan-1-one;ethyl acetate is sourced from PubChem (CID 70391685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).