C18H25N6NaO11S — CID 70391846
sodium 3-[[4-[(2-ethoxy-2-oxoethyl)amino]-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonate (PubChem CID 70391846) has the molecular formula C18H25N6NaO11S and a molecular weight of 556.49 g/mol. Its IUPAC name is sodium 3-[[4-[(2-ethoxy-2-oxoethyl)amino]-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonate.
| Compound Name | sodium 3-[[4-[(2-ethoxy-2-oxoethyl)amino]-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 70391846 |
| Molecular Formula | C18H25N6NaO11S |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | sodium 3-[[4-[(2-ethoxy-2-oxoethyl)amino]-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonate |
| SMILES | CCOC(=O)CNC(=O)CC(NC(=O)N1CCN(CC)C(=O)C1=O)C(=O)NC1CN(S(=O)(=O)[O-])C1=O.[Na+] |
| InChI | InChI=1S/C18H26N6O11S.Na/c1-3-22-5-6-23(17(30)16(22)29)18(31)21-10(7-12(25)19-8-13(26)35-4-2)14(27)20-11-9-24(15(11)28)36(32,33)34;/h10-11H,3-9H2,1-2H3,(H,19,25)(H,20,27)(H,21,31)(H,32,33,34);/q;+1/p-1 |
| InChIKey | LWQYRYCNNOLVOE-UHFFFAOYSA-M |
| XLogP | -7.38 |
| TPSA | 231.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | -7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|