C18H19ClN5NaO9S — CID 70391934
sodium 3-[[2-(3-chloro-4-hydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-oxoazetidine-1-sulfonate (PubChem CID 70391934) has the molecular formula C18H19ClN5NaO9S and a molecular weight of 539.89 g/mol. Its IUPAC name is sodium 3-[[2-(3-chloro-4-hydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-oxoazetidine-1-sulfonate.
| Compound Name | sodium 3-[[2-(3-chloro-4-hydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 70391934 |
| Molecular Formula | C18H19ClN5NaO9S |
| Molecular Weight | 539.89 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | sodium 3-[[2-(3-chloro-4-hydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-oxoazetidine-1-sulfonate |
| SMILES | CCN1CCN(C(=O)NC(C(=O)NC2CN(S(=O)(=O)[O-])C2=O)c2ccc(O)c(Cl)c2)C(=O)C1=O.[Na+] |
| InChI | InChI=1S/C18H20ClN5O9S.Na/c1-2-22-5-6-23(17(29)16(22)28)18(30)21-13(9-3-4-12(25)10(19)7-9)14(26)20-11-8-24(15(11)27)34(31,32)33;/h3-4,7,11,13,25H,2,5-6,8H2,1H3,(H,20,26)(H,21,30)(H,31,32,33);/q;+1/p-1 |
| InChIKey | IKBAWWYXZMSBNN-UHFFFAOYSA-M |
| XLogP | -4.72 |
| TPSA | 196.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.89 |
| LogP ≤ 5 | -4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|