C5H6ClF4NO2 — CID 7039203
(2R)-2-chloro-2,3,3,3-tetrafluoro-N-(2-hydroxyethyl)propanamide (PubChem CID 7039203) has the molecular formula C5H6ClF4NO2 and a molecular weight of 223.55 g/mol. Its IUPAC name is (2R)-2-chloro-2,3,3,3-tetrafluoro-N-(2-hydroxyethyl)propanamide.
| Compound Name | (2R)-2-chloro-2,3,3,3-tetrafluoro-N-(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 7039203 |
| Molecular Formula | C5H6ClF4NO2 |
| Molecular Weight | 223.55 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | (2R)-2-chloro-2,3,3,3-tetrafluoro-N-(2-hydroxyethyl)propanamide |
| SMILES | O=C(NCCO)[C@@](F)(Cl)C(F)(F)F |
| InChI | InChI=1S/C5H6ClF4NO2/c6-4(7,5(8,9)10)3(13)11-1-2-12/h12H,1-2H2,(H,11,13)/t4-/m0/s1 |
| InChIKey | MGVYQAPJBMLSJG-BYPYZUCNSA-N |
| XLogP | 0.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.55 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|