C11H16N2O — CID 70392241
3-prop-2-enyl-3,4,4a,5,6,8a-hexahydro-1H-quinoxalin-2-one (PubChem CID 70392241) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-prop-2-enyl-3,4,4a,5,6,8a-hexahydro-1H-quinoxalin-2-one.
| Compound Name | 3-prop-2-enyl-3,4,4a,5,6,8a-hexahydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 70392241 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3-prop-2-enyl-3,4,4a,5,6,8a-hexahydro-1H-quinoxalin-2-one |
| SMILES | C=CCC1NC2CCC=CC2NC1=O |
| InChI | InChI=1S/C11H16N2O/c1-2-5-10-11(14)13-9-7-4-3-6-8(9)12-10/h2,4,7-10,12H,1,3,5-6H2,(H,13,14) |
| InChIKey | PCCNJHHBORQABB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|