C11H14N2O — CID 70392242
1-prop-2-enyl-3,4,4a,5-tetrahydroquinoxalin-2-one (PubChem CID 70392242) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-prop-2-enyl-3,4,4a,5-tetrahydroquinoxalin-2-one.
| Compound Name | 1-prop-2-enyl-3,4,4a,5-tetrahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 70392242 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-prop-2-enyl-3,4,4a,5-tetrahydroquinoxalin-2-one |
| SMILES | C=CCN1C(=O)CNC2CC=CC=C21 |
| InChI | InChI=1S/C11H14N2O/c1-2-7-13-10-6-4-3-5-9(10)12-8-11(13)14/h2-4,6,9,12H,1,5,7-8H2 |
| InChIKey | DKEWWWOKGXUQIB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|