About sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate
sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate (PubChem CID 70392300) has the molecular formula C10H13N4NaO7S
and a molecular weight of 356.29 g/mol. Its IUPAC name is sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate.
Molecular Properties
| Compound Name | sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate |
| PubChem CID | 70392300 |
| Molecular Formula | C10H13N4NaO7S |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate |
| SMILES | CCN1CCN(C(=O)NC2CN(S(=O)(=O)[O-])C2=O)C(=O)C1=O.[Na+] |
| InChI | InChI=1S/C10H14N4O7S.Na/c1-2-12-3-4-13(9(17)8(12)16)10(18)11-6-5-14(7(6)15)22(19,20)21;/h6H,2-5H2,1H3,(H,11,18)(H,19,20,21);/q;+1/p-1 |
| InChIKey | UCACVNOBHABGMF-UHFFFAOYSA-M |
| XLogP | -5.94 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | -5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate?
The IUPAC name of sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate (CID 70392300) is sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate.
What is the SMILES notation for sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate?
The canonical SMILES for sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate is CCN1CCN(C(=O)NC2CN(S(=O)(=O)[O-])C2=O)C(=O)C1=O.[Na+].
What is the InChIKey of sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate?
The InChIKey is UCACVNOBHABGMF-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H14N4O7S.Na/c1-2-12-3-4-13(9(17)8(12)16)10(18)11-6-5-14(7(6)15)22(19,20)21;/h6H,2-5H2,1H3,(H,11,18)(H,19,20,21);/q;+1/p-1.
What are the key properties of sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate?
sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate has a molecular weight of 356.29 g/mol, XLogP of -5.94, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate is sourced from PubChem (CID 70392300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).