C23H26Cl2NPS — CID 7039238
bis(2-chloro-2-phenylethenyl)-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-sulfanylidene-lambda5-phosphane (PubChem CID 7039238) has the molecular formula C23H26Cl2NPS and a molecular weight of 450.42 g/mol. Its IUPAC name is bis(2-chloro-2-phenylethenyl)-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-sulfanylidene-lambda5-phosphane.
| Compound Name | bis(2-chloro-2-phenylethenyl)-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-sulfanylidene-lambda5-phosphane |
|---|---|
| PubChem CID | 7039238 |
| Molecular Formula | C23H26Cl2NPS |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | bis(2-chloro-2-phenylethenyl)-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-sulfanylidene-lambda5-phosphane |
| SMILES | C[C@@H]1C[C@H](C)CN(P(=S)(C=C(Cl)c2ccccc2)C=C(Cl)c2ccccc2)C1 |
| InChI | InChI=1S/C23H26Cl2NPS/c1-18-13-19(2)15-26(14-18)27(28,16-22(24)20-9-5-3-6-10-20)17-23(25)21-11-7-4-8-12-21/h3-12,16-19H,13-15H2,1-2H3/t18-,19+,27? |
| InChIKey | IEGVNRAPLIGAOC-WEWIIKPSSA-N |
| XLogP | 7.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|