About 7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide
7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide (PubChem CID 70392839) has the molecular formula C13H12N4O
and a molecular weight of 240.27 g/mol. Its IUPAC name is 7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide |
| PubChem CID | 70392839 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cc(C2C=CCC=C2)n2nccc2n1 |
| InChI | InChI=1S/C13H12N4O/c14-13(18)10-8-11(9-4-2-1-3-5-9)17-12(16-10)6-7-15-17/h2-9H,1H2,(H2,14,18) |
| InChIKey | YUZGJCUTPFSQGK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide?
The IUPAC name of 7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide (CID 70392839) is 7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide.
What is the SMILES notation for 7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide?
The canonical SMILES for 7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide is NC(=O)c1cc(C2C=CCC=C2)n2nccc2n1.
What is the InChIKey of 7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide?
The InChIKey is YUZGJCUTPFSQGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O/c14-13(18)10-8-11(9-4-2-1-3-5-9)17-12(16-10)6-7-15-17/h2-9H,1H2,(H2,14,18).
What are the key properties of 7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide?
7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide has a molecular weight of 240.27 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclohexa-2,5-dien-1-ylpyrazolo[1,5-a]pyrimidine-5-carboxamide is sourced from PubChem (CID 70392839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).