C14H24O3 — CID 70392937
(3R,4S)-2,4-dimethyl-3-[[(2S)-2H-pyran-2-yl]oxy]heptan-1-ol (PubChem CID 70392937) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (3R,4S)-2,4-dimethyl-3-[[(2S)-2H-pyran-2-yl]oxy]heptan-1-ol.
| Compound Name | (3R,4S)-2,4-dimethyl-3-[[(2S)-2H-pyran-2-yl]oxy]heptan-1-ol |
|---|---|
| PubChem CID | 70392937 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (3R,4S)-2,4-dimethyl-3-[[(2S)-2H-pyran-2-yl]oxy]heptan-1-ol |
| SMILES | CCC[C@H](C)[C@@H](O[C@H]1C=CC=CO1)C(C)CO |
| InChI | InChI=1S/C14H24O3/c1-4-7-11(2)14(12(3)10-15)17-13-8-5-6-9-16-13/h5-6,8-9,11-15H,4,7,10H2,1-3H3/t11-,12?,13-,14+/m0/s1 |
| InChIKey | FIKZALUTOVBJBI-FUDCBSFHSA-N |
| XLogP | 2.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |