C16H15Cl2F2N3O4 — CID 70393456
2-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenoxy]-2-methylpent-3-enoic acid (PubChem CID 70393456) has the molecular formula C16H15Cl2F2N3O4 and a molecular weight of 422.22 g/mol. Its IUPAC name is 2-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenoxy]-2-methylpent-3-enoic acid.
| Compound Name | 2-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenoxy]-2-methylpent-3-enoic acid |
|---|---|
| PubChem CID | 70393456 |
| Molecular Formula | C16H15Cl2F2N3O4 |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 2-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenoxy]-2-methylpent-3-enoic acid |
| SMILES | CC=CC(C)(Oc1cc(-n2nc(C)n(C(F)F)c2=O)c(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C16H15Cl2F2N3O4/c1-4-5-16(3,13(24)25)27-12-7-11(9(17)6-10(12)18)23-15(26)22(14(19)20)8(2)21-23/h4-7,14H,1-3H3,(H,24,25) |
| InChIKey | XBSJTTPPZAPIRN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|