C23H36O3 — CID 70393554
(8E,12E)-2,2,8,12-tetramethyl-14-(oxan-2-yloxy)tetradeca-8,12-dien-3-yn-5-one (PubChem CID 70393554) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (8E,12E)-2,2,8,12-tetramethyl-14-(oxan-2-yloxy)tetradeca-8,12-dien-3-yn-5-one.
| Compound Name | (8E,12E)-2,2,8,12-tetramethyl-14-(oxan-2-yloxy)tetradeca-8,12-dien-3-yn-5-one |
|---|---|
| PubChem CID | 70393554 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (8E,12E)-2,2,8,12-tetramethyl-14-(oxan-2-yloxy)tetradeca-8,12-dien-3-yn-5-one |
| SMILES | C/C(=C\COC1CCCCO1)CC/C=C(\C)CCC(=O)C#CC(C)(C)C |
| InChI | InChI=1S/C23H36O3/c1-19(12-13-21(24)14-16-23(3,4)5)9-8-10-20(2)15-18-26-22-11-6-7-17-25-22/h9,15,22H,6-8,10-13,17-18H2,1-5H3/b19-9+,20-15+ |
| InChIKey | HHTJYLQSUYTWOK-WOWYBKFKSA-N |
| XLogP | 5.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|