About 4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine
4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine (PubChem CID 70393584) has the molecular formula C9H10FN3S
and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine |
| PubChem CID | 70393584 |
| Molecular Formula | C9H10FN3S |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine |
| SMILES | Cc1sc(F)c(-c2cn[nH]c2N)c1C |
| InChI | InChI=1S/C9H10FN3S/c1-4-5(2)14-8(10)7(4)6-3-12-13-9(6)11/h3H,1-2H3,(H3,11,12,13) |
| InChIKey | BTUKYWPUDJDSQJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine?
The IUPAC name of 4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine (CID 70393584) is 4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine.
What is the SMILES notation for 4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine?
The canonical SMILES for 4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine is Cc1sc(F)c(-c2cn[nH]c2N)c1C.
What is the InChIKey of 4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine?
The InChIKey is BTUKYWPUDJDSQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN3S/c1-4-5(2)14-8(10)7(4)6-3-12-13-9(6)11/h3H,1-2H3,(H3,11,12,13).
What are the key properties of 4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine?
4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine has a molecular weight of 211.26 g/mol, XLogP of 2.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluoro-4,5-dimethylthiophen-3-yl)-1H-pyrazol-5-amine is sourced from PubChem (CID 70393584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).