C12H17F3N6O2 — CID 70393794
methyl 5-imino-5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanoate (PubChem CID 70393794) has the molecular formula C12H17F3N6O2 and a molecular weight of 334.30 g/mol. Its IUPAC name is methyl 5-imino-5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanoate.
| Compound Name | methyl 5-imino-5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 70393794 |
| Molecular Formula | C12H17F3N6O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | methyl 5-imino-5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanoate |
| SMILES | [H]/N=C(\CCCC(=O)OC)n1ccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N6O2/c1-23-10(22)4-2-3-8(16)21-6-5-9(20-21)19-11(17)18-7-12(13,14)15/h5-6,16H,2-4,7H2,1H3,(H3,17,18,19,20)/b16-8+ |
| InChIKey | TWIVTBGNIFJAHH-LZYBPNLTSA-N |
| XLogP | 1.34 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|