C18H23N3O8 — CID 70393901
but-2-enedioic acid;2-[2-(dimethylamino)ethyl]-4-methyl-7-nitro-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 70393901) has the molecular formula C18H23N3O8 and a molecular weight of 409.40 g/mol. Its IUPAC name is but-2-enedioic acid;2-[2-(dimethylamino)ethyl]-4-methyl-7-nitro-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | but-2-enedioic acid;2-[2-(dimethylamino)ethyl]-4-methyl-7-nitro-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 70393901 |
| Molecular Formula | C18H23N3O8 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | but-2-enedioic acid;2-[2-(dimethylamino)ethyl]-4-methyl-7-nitro-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | CN(C)CCC1CN(C)C(=O)c2cc([N+](=O)[O-])ccc2O1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C14H19N3O4.C4H4O4/c1-15(2)7-6-11-9-16(3)14(18)12-8-10(17(19)20)4-5-13(12)21-11;5-3(6)1-2-4(7)8/h4-5,8,11H,6-7,9H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | GTMFIAAEMPWDPN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 150.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|